C23H35F2N5O3 — CID 137399131
2-(butylamino)-N-[4-(difluoromethoxy)cyclohexyl]-4-[(4-hydroxycyclohexyl)methylideneamino]pyrimidine-5-carboxamide (PubChem CID 137399131) has the molecular formula C23H35F2N5O3 and a molecular weight of 467.56 g/mol. Its IUPAC name is 2-(butylamino)-N-[4-(difluoromethoxy)cyclohexyl]-4-[(4-hydroxycyclohexyl)methylideneamino]pyrimidine-5-carboxamide.
| Compound Name | 2-(butylamino)-N-[4-(difluoromethoxy)cyclohexyl]-4-[(4-hydroxycyclohexyl)methylideneamino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 137399131 |
| Molecular Formula | C23H35F2N5O3 |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | 2-(butylamino)-N-[4-(difluoromethoxy)cyclohexyl]-4-[(4-hydroxycyclohexyl)methylideneamino]pyrimidine-5-carboxamide |
| SMILES | CCCCNc1ncc(C(=O)NC2CCC(OC(F)F)CC2)c(/N=C/C2CCC(O)CC2)n1 |
| InChI | InChI=1S/C23H35F2N5O3/c1-2-3-12-26-23-28-14-19(20(30-23)27-13-15-4-8-17(31)9-5-15)21(32)29-16-6-10-18(11-7-16)33-22(24)25/h13-18,22,31H,2-12H2,1H3,(H,29,32)(H,26,28,30)/b27-13+ |
| InChIKey | UEBFTSMALOYLTL-UVHMKAGCSA-N |
| XLogP | 4.22 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|