C20H30F2N6O3 — CID 137399625
2-[2-(difluoromethoxy)ethylamino]-4-[(4-hydroxycyclohexyl)methylideneamino]-N-[(3R)-piperidin-3-yl]pyrimidine-5-carboxamide (PubChem CID 137399625) has the molecular formula C20H30F2N6O3 and a molecular weight of 440.50 g/mol. Its IUPAC name is 2-[2-(difluoromethoxy)ethylamino]-4-[(4-hydroxycyclohexyl)methylideneamino]-N-[(3R)-piperidin-3-yl]pyrimidine-5-carboxamide.
| Compound Name | 2-[2-(difluoromethoxy)ethylamino]-4-[(4-hydroxycyclohexyl)methylideneamino]-N-[(3R)-piperidin-3-yl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 137399625 |
| Molecular Formula | C20H30F2N6O3 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 2-[2-(difluoromethoxy)ethylamino]-4-[(4-hydroxycyclohexyl)methylideneamino]-N-[(3R)-piperidin-3-yl]pyrimidine-5-carboxamide |
| SMILES | O=C(N[C@@H]1CCCNC1)c1cnc(NCCOC(F)F)nc1/N=C/C1CCC(O)CC1 |
| InChI | InChI=1S/C20H30F2N6O3/c21-19(22)31-9-8-24-20-26-12-16(18(30)27-14-2-1-7-23-11-14)17(28-20)25-10-13-3-5-15(29)6-4-13/h10,12-15,19,23,29H,1-9,11H2,(H,27,30)(H,24,26,28)/b25-10+/t13?,14-,15?/m1/s1 |
| InChIKey | REVZOHKUWRTWGN-MGNPRUEQSA-N |
| XLogP | 1.86 |
| TPSA | 120.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|