C15H22F2N4O4 — CID 137379965
methyl 2-[2-(difluoromethoxy)ethylamino]-4-[(4-hydroxycyclohexyl)amino]pyrimidine-5-carboxylate (PubChem CID 137379965) has the molecular formula C15H22F2N4O4 and a molecular weight of 360.36 g/mol. Its IUPAC name is methyl 2-[2-(difluoromethoxy)ethylamino]-4-[(4-hydroxycyclohexyl)amino]pyrimidine-5-carboxylate.
| Compound Name | methyl 2-[2-(difluoromethoxy)ethylamino]-4-[(4-hydroxycyclohexyl)amino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 137379965 |
| Molecular Formula | C15H22F2N4O4 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | methyl 2-[2-(difluoromethoxy)ethylamino]-4-[(4-hydroxycyclohexyl)amino]pyrimidine-5-carboxylate |
| SMILES | COC(=O)c1cnc(NCCOC(F)F)nc1NC1CCC(O)CC1 |
| InChI | InChI=1S/C15H22F2N4O4/c1-24-13(23)11-8-19-15(18-6-7-25-14(16)17)21-12(11)20-9-2-4-10(22)5-3-9/h8-10,14,22H,2-7H2,1H3,(H2,18,19,20,21) |
| InChIKey | GGEKMMLGAVTLJJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|