C17H27N5O2 — CID 71244293
4-[(3-ethylcyclobutyl)amino]-2-[(4-hydroxycyclohexyl)amino]pyrimidine-5-carboxamide (PubChem CID 71244293) has the molecular formula C17H27N5O2 and a molecular weight of 333.44 g/mol. Its IUPAC name is 4-[(3-ethylcyclobutyl)amino]-2-[(4-hydroxycyclohexyl)amino]pyrimidine-5-carboxamide.
| Compound Name | 4-[(3-ethylcyclobutyl)amino]-2-[(4-hydroxycyclohexyl)amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 71244293 |
| Molecular Formula | C17H27N5O2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | 4-[(3-ethylcyclobutyl)amino]-2-[(4-hydroxycyclohexyl)amino]pyrimidine-5-carboxamide |
| SMILES | CCC1CC(Nc2nc(NC3CCC(O)CC3)ncc2C(N)=O)C1 |
| InChI | InChI=1S/C17H27N5O2/c1-2-10-7-12(8-10)20-16-14(15(18)24)9-19-17(22-16)21-11-3-5-13(23)6-4-11/h9-13,23H,2-8H2,1H3,(H2,18,24)(H2,19,20,21,22) |
| InChIKey | WHNSNWCVQAZMLQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |