C17H29N5O2 — CID 71238055
2-[(4-hydroxycyclohexyl)amino]-4-(2-methylpentan-2-ylamino)pyrimidine-5-carboxamide (PubChem CID 71238055) has the molecular formula C17H29N5O2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-[(4-hydroxycyclohexyl)amino]-4-(2-methylpentan-2-ylamino)pyrimidine-5-carboxamide.
| Compound Name | 2-[(4-hydroxycyclohexyl)amino]-4-(2-methylpentan-2-ylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 71238055 |
| Molecular Formula | C17H29N5O2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | 2-[(4-hydroxycyclohexyl)amino]-4-(2-methylpentan-2-ylamino)pyrimidine-5-carboxamide |
| SMILES | CCCC(C)(C)Nc1nc(NC2CCC(O)CC2)ncc1C(N)=O |
| InChI | InChI=1S/C17H29N5O2/c1-4-9-17(2,3)22-15-13(14(18)24)10-19-16(21-15)20-11-5-7-12(23)8-6-11/h10-12,23H,4-9H2,1-3H3,(H2,18,24)(H2,19,20,21,22) |
| InChIKey | ROWBIMUYZMZARY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |