C18H30N6O2 — CID 66576316
4-[(4-aminocyclohexyl)amino]-2-[(4-methoxycyclohexyl)amino]pyrimidine-5-carboxamide (PubChem CID 66576316) has the molecular formula C18H30N6O2 and a molecular weight of 362.48 g/mol. Its IUPAC name is 4-[(4-aminocyclohexyl)amino]-2-[(4-methoxycyclohexyl)amino]pyrimidine-5-carboxamide.
| Compound Name | 4-[(4-aminocyclohexyl)amino]-2-[(4-methoxycyclohexyl)amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 66576316 |
| Molecular Formula | C18H30N6O2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 4-[(4-aminocyclohexyl)amino]-2-[(4-methoxycyclohexyl)amino]pyrimidine-5-carboxamide |
| SMILES | COC1CCC(Nc2ncc(C(N)=O)c(NC3CCC(N)CC3)n2)CC1 |
| InChI | InChI=1S/C18H30N6O2/c1-26-14-8-6-13(7-9-14)23-18-21-10-15(16(20)25)17(24-18)22-12-4-2-11(19)3-5-12/h10-14H,2-9,19H2,1H3,(H2,20,25)(H2,21,22,23,24) |
| InChIKey | GPHKCWPADUOOKO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 128.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |