C13H20N4O4S — CID 70982679
2-[(4-methoxycyclohexyl)amino]-4-methylsulfonylpyrimidine-5-carboxamide (PubChem CID 70982679) has the molecular formula C13H20N4O4S and a molecular weight of 328.39 g/mol. Its IUPAC name is 2-[(4-methoxycyclohexyl)amino]-4-methylsulfonylpyrimidine-5-carboxamide.
| Compound Name | 2-[(4-methoxycyclohexyl)amino]-4-methylsulfonylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 70982679 |
| Molecular Formula | C13H20N4O4S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 2-[(4-methoxycyclohexyl)amino]-4-methylsulfonylpyrimidine-5-carboxamide |
| SMILES | COC1CCC(Nc2ncc(C(N)=O)c(S(C)(=O)=O)n2)CC1 |
| InChI | InChI=1S/C13H20N4O4S/c1-21-9-5-3-8(4-6-9)16-13-15-7-10(11(14)18)12(17-13)22(2,19)20/h7-9H,3-6H2,1-2H3,(H2,14,18)(H,15,16,17) |
| InChIKey | MBTMTUXOBFMDIU-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 124.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |