C17H29N5O2 — CID 71237470
2-[(4-methoxycyclohexyl)amino]-4-[[(2S)-3-methylbutan-2-yl]amino]pyrimidine-5-carboxamide (PubChem CID 71237470) has the molecular formula C17H29N5O2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-[(4-methoxycyclohexyl)amino]-4-[[(2S)-3-methylbutan-2-yl]amino]pyrimidine-5-carboxamide.
| Compound Name | 2-[(4-methoxycyclohexyl)amino]-4-[[(2S)-3-methylbutan-2-yl]amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 71237470 |
| Molecular Formula | C17H29N5O2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | 2-[(4-methoxycyclohexyl)amino]-4-[[(2S)-3-methylbutan-2-yl]amino]pyrimidine-5-carboxamide |
| SMILES | COC1CCC(Nc2ncc(C(N)=O)c(N[C@@H](C)C(C)C)n2)CC1 |
| InChI | InChI=1S/C17H29N5O2/c1-10(2)11(3)20-16-14(15(18)23)9-19-17(22-16)21-12-5-7-13(24-4)8-6-12/h9-13H,5-8H2,1-4H3,(H2,18,23)(H2,19,20,21,22)/t11-,12?,13?/m0/s1 |
| InChIKey | PIPIZKSPIVLWHA-HIFPTAJRSA-N |
| XLogP | 2.40 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |