C18H27F2N5O4 — CID 137399120
2-[2-(difluoromethoxy)ethylamino]-4-[(4-hydroxycyclohexyl)methylideneamino]-N-(2-methoxyethyl)pyrimidine-5-carboxamide (PubChem CID 137399120) has the molecular formula C18H27F2N5O4 and a molecular weight of 415.44 g/mol. Its IUPAC name is 2-[2-(difluoromethoxy)ethylamino]-4-[(4-hydroxycyclohexyl)methylideneamino]-N-(2-methoxyethyl)pyrimidine-5-carboxamide.
| Compound Name | 2-[2-(difluoromethoxy)ethylamino]-4-[(4-hydroxycyclohexyl)methylideneamino]-N-(2-methoxyethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 137399120 |
| Molecular Formula | C18H27F2N5O4 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 2-[2-(difluoromethoxy)ethylamino]-4-[(4-hydroxycyclohexyl)methylideneamino]-N-(2-methoxyethyl)pyrimidine-5-carboxamide |
| SMILES | COCCNC(=O)c1cnc(NCCOC(F)F)nc1/N=C/C1CCC(O)CC1 |
| InChI | InChI=1S/C18H27F2N5O4/c1-28-8-6-21-16(27)14-11-24-18(22-7-9-29-17(19)20)25-15(14)23-10-12-2-4-13(26)5-3-12/h10-13,17,26H,2-9H2,1H3,(H,21,27)(H,22,24,25)/b23-10+ |
| InChIKey | DORUPTUKSZAIBA-AUEPDCJTSA-N |
| XLogP | 1.76 |
| TPSA | 117.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|