C20H31F2N5O3 — CID 137399562
2-(butylamino)-N-[(2R)-1-(difluoromethoxy)propan-2-yl]-4-[(4-hydroxycyclohexyl)methylideneamino]pyrimidine-5-carboxamide (PubChem CID 137399562) has the molecular formula C20H31F2N5O3 and a molecular weight of 427.50 g/mol. Its IUPAC name is 2-(butylamino)-N-[(2R)-1-(difluoromethoxy)propan-2-yl]-4-[(4-hydroxycyclohexyl)methylideneamino]pyrimidine-5-carboxamide.
| Compound Name | 2-(butylamino)-N-[(2R)-1-(difluoromethoxy)propan-2-yl]-4-[(4-hydroxycyclohexyl)methylideneamino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 137399562 |
| Molecular Formula | C20H31F2N5O3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | 2-(butylamino)-N-[(2R)-1-(difluoromethoxy)propan-2-yl]-4-[(4-hydroxycyclohexyl)methylideneamino]pyrimidine-5-carboxamide |
| SMILES | CCCCNc1ncc(C(=O)N[C@H](C)COC(F)F)c(/N=C/C2CCC(O)CC2)n1 |
| InChI | InChI=1S/C20H31F2N5O3/c1-3-4-9-23-20-25-11-16(18(29)26-13(2)12-30-19(21)22)17(27-20)24-10-14-5-7-15(28)8-6-14/h10-11,13-15,19,28H,3-9,12H2,1-2H3,(H,26,29)(H,23,25,27)/b24-10+/t13-,14?,15?/m1/s1 |
| InChIKey | HYXVOCOCAOWHRJ-ZLEMJVQOSA-N |
| XLogP | 3.30 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|