C16H16FN7O3 — CID 69150463
(2R)-2-(4-fluorophenyl)-2-[[4-[(5-methyl-1H-pyrazol-3-yl)amino]-5-nitropyrimidin-2-yl]amino]ethanol (PubChem CID 69150463) has the molecular formula C16H16FN7O3 and a molecular weight of 373.35 g/mol. Its IUPAC name is (2R)-2-(4-fluorophenyl)-2-[[4-[(5-methyl-1H-pyrazol-3-yl)amino]-5-nitropyrimidin-2-yl]amino]ethanol.
| Compound Name | (2R)-2-(4-fluorophenyl)-2-[[4-[(5-methyl-1H-pyrazol-3-yl)amino]-5-nitropyrimidin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 69150463 |
| Molecular Formula | C16H16FN7O3 |
| Molecular Weight | 373.35 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | (2R)-2-(4-fluorophenyl)-2-[[4-[(5-methyl-1H-pyrazol-3-yl)amino]-5-nitropyrimidin-2-yl]amino]ethanol |
| SMILES | Cc1cc(Nc2nc(N[C@@H](CO)c3ccc(F)cc3)ncc2[N+](=O)[O-])n[nH]1 |
| InChI | InChI=1S/C16H16FN7O3/c1-9-6-14(23-22-9)20-15-13(24(26)27)7-18-16(21-15)19-12(8-25)10-2-4-11(17)5-3-10/h2-7,12,25H,8H2,1H3,(H3,18,19,20,21,22,23)/t12-/m0/s1 |
| InChIKey | UDRXNQDDAKUISQ-LBPRGKRZSA-N |
| XLogP | 2.44 |
| TPSA | 141.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|