C17H18FN7O4 — CID 68736639
(2R)-2-[[6-[(3-ethoxy-1H-pyrazol-5-yl)amino]-5-nitro-2-pyridinyl]amino]-2-(5-fluoro-2-pyridinyl)ethanol (PubChem CID 68736639) has the molecular formula C17H18FN7O4 and a molecular weight of 403.37 g/mol. Its IUPAC name is (2R)-2-[[6-[(3-ethoxy-1H-pyrazol-5-yl)amino]-5-nitro-2-pyridinyl]amino]-2-(5-fluoro-2-pyridinyl)ethanol.
| Compound Name | (2R)-2-[[6-[(3-ethoxy-1H-pyrazol-5-yl)amino]-5-nitro-2-pyridinyl]amino]-2-(5-fluoro-2-pyridinyl)ethanol |
|---|---|
| PubChem CID | 68736639 |
| Molecular Formula | C17H18FN7O4 |
| Molecular Weight | 403.37 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | (2R)-2-[[6-[(3-ethoxy-1H-pyrazol-5-yl)amino]-5-nitro-2-pyridinyl]amino]-2-(5-fluoro-2-pyridinyl)ethanol |
| SMILES | CCOc1cc(Nc2nc(N[C@@H](CO)c3ccc(F)cn3)ccc2[N+](=O)[O-])[nH]n1 |
| InChI | InChI=1S/C17H18FN7O4/c1-2-29-16-7-15(23-24-16)22-17-13(25(27)28)5-6-14(21-17)20-12(9-26)11-4-3-10(18)8-19-11/h3-8,12,26H,2,9H2,1H3,(H3,20,21,22,23,24)/t12-/m0/s1 |
| InChIKey | RCILATDXAWEBNW-LBPRGKRZSA-N |
| XLogP | 2.53 |
| TPSA | 151.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|