C20H22ClFN6O3 — CID 77295150
2-[[6-[(5-tert-butyl-1H-pyrazol-3-yl)amino]-5-chloro-3-nitro-2-pyridinyl]amino]-2-(4-fluorophenyl)ethanol (PubChem CID 77295150) has the molecular formula C20H22ClFN6O3 and a molecular weight of 448.89 g/mol. Its IUPAC name is 2-[[6-[(5-tert-butyl-1H-pyrazol-3-yl)amino]-5-chloro-3-nitro-2-pyridinyl]amino]-2-(4-fluorophenyl)ethanol.
| Compound Name | 2-[[6-[(5-tert-butyl-1H-pyrazol-3-yl)amino]-5-chloro-3-nitro-2-pyridinyl]amino]-2-(4-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 77295150 |
| Molecular Formula | C20H22ClFN6O3 |
| Molecular Weight | 448.89 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 2-[[6-[(5-tert-butyl-1H-pyrazol-3-yl)amino]-5-chloro-3-nitro-2-pyridinyl]amino]-2-(4-fluorophenyl)ethanol |
| SMILES | CC(C)(C)c1cc(Nc2nc(NC(CO)c3ccc(F)cc3)c([N+](=O)[O-])cc2Cl)n[nH]1 |
| InChI | InChI=1S/C20H22ClFN6O3/c1-20(2,3)16-9-17(27-26-16)24-18-13(21)8-15(28(30)31)19(25-18)23-14(10-29)11-4-6-12(22)7-5-11/h4-9,14,29H,10H2,1-3H3,(H3,23,24,25,26,27) |
| InChIKey | ZIBMRAQGPGODTN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 129.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.89 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|