C19H18F2N6O2 — CID 77294915
2-N-(5-cyclopropyl-1H-pyrazol-3-yl)-3-fluoro-6-N-[1-(4-fluorophenyl)ethyl]-5-nitropyridine-2,6-diamine (PubChem CID 77294915) has the molecular formula C19H18F2N6O2 and a molecular weight of 400.39 g/mol. Its IUPAC name is 2-N-(5-cyclopropyl-1H-pyrazol-3-yl)-3-fluoro-6-N-[1-(4-fluorophenyl)ethyl]-5-nitropyridine-2,6-diamine.
| Compound Name | 2-N-(5-cyclopropyl-1H-pyrazol-3-yl)-3-fluoro-6-N-[1-(4-fluorophenyl)ethyl]-5-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 77294915 |
| Molecular Formula | C19H18F2N6O2 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 2-N-(5-cyclopropyl-1H-pyrazol-3-yl)-3-fluoro-6-N-[1-(4-fluorophenyl)ethyl]-5-nitropyridine-2,6-diamine |
| SMILES | CC(Nc1nc(Nc2cc(C3CC3)[nH]n2)c(F)cc1[N+](=O)[O-])c1ccc(F)cc1 |
| InChI | InChI=1S/C19H18F2N6O2/c1-10(11-4-6-13(20)7-5-11)22-19-16(27(28)29)8-14(21)18(24-19)23-17-9-15(25-26-17)12-2-3-12/h4-10,12H,2-3H2,1H3,(H3,22,23,24,25,26) |
| InChIKey | MYBIPSUVVPSCHZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|