C18H16F2N6O2 — CID 90711232
2-N-(5-cyclopropyl-1H-pyrazol-3-yl)-3-fluoro-6-N-[(4-fluorophenyl)methyl]-5-nitropyridine-2,6-diamine (PubChem CID 90711232) has the molecular formula C18H16F2N6O2 and a molecular weight of 386.36 g/mol. Its IUPAC name is 2-N-(5-cyclopropyl-1H-pyrazol-3-yl)-3-fluoro-6-N-[(4-fluorophenyl)methyl]-5-nitropyridine-2,6-diamine.
| Compound Name | 2-N-(5-cyclopropyl-1H-pyrazol-3-yl)-3-fluoro-6-N-[(4-fluorophenyl)methyl]-5-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 90711232 |
| Molecular Formula | C18H16F2N6O2 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 2-N-(5-cyclopropyl-1H-pyrazol-3-yl)-3-fluoro-6-N-[(4-fluorophenyl)methyl]-5-nitropyridine-2,6-diamine |
| SMILES | O=[N+]([O-])c1cc(F)c(Nc2cc(C3CC3)[nH]n2)nc1NCc1ccc(F)cc1 |
| InChI | InChI=1S/C18H16F2N6O2/c19-12-5-1-10(2-6-12)9-21-18-15(26(27)28)7-13(20)17(23-18)22-16-8-14(24-25-16)11-3-4-11/h1-2,5-8,11H,3-4,9H2,(H3,21,22,23,24,25) |
| InChIKey | HZCFYRSILRKBIS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|