C28H37N5O2S — CID 71596865
ethyl 1-[[3-(1-adamantyl)-4-[(E)-benzylideneamino]-5-sulfanylidene-1,2,4-triazol-1-yl]methyl]piperidine-4-carboxylate (PubChem CID 71596865) has the molecular formula C28H37N5O2S and a molecular weight of 507.70 g/mol. Its IUPAC name is ethyl 1-[[3-(1-adamantyl)-4-[(E)-benzylideneamino]-5-sulfanylidene-1,2,4-triazol-1-yl]methyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[[3-(1-adamantyl)-4-[(E)-benzylideneamino]-5-sulfanylidene-1,2,4-triazol-1-yl]methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 71596865 |
| Molecular Formula | C28H37N5O2S |
| Molecular Weight | 507.70 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | ethyl 1-[[3-(1-adamantyl)-4-[(E)-benzylideneamino]-5-sulfanylidene-1,2,4-triazol-1-yl]methyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(Cn2nc(C34CC5CC(CC(C5)C3)C4)n(/N=C/c3ccccc3)c2=S)CC1 |
| InChI | InChI=1S/C28H37N5O2S/c1-2-35-25(34)24-8-10-31(11-9-24)19-32-27(36)33(29-18-20-6-4-3-5-7-20)26(30-32)28-15-21-12-22(16-28)14-23(13-21)17-28/h3-7,18,21-24H,2,8-17,19H2,1H3/b29-18+ |
| InChIKey | GWEOVCJMBBGILZ-RDRPBHBLSA-N |
| XLogP | 5.00 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.70 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|