C12H12N4O2S — CID 3527365
ethyl 4-(benzylideneamino)-5-sulfanylidene-1,2,4-triazole-1-carboxylate (PubChem CID 3527365) has the molecular formula C12H12N4O2S and a molecular weight of 276.32 g/mol. Its IUPAC name is ethyl 4-(benzylideneamino)-5-sulfanylidene-1,2,4-triazole-1-carboxylate.
| Compound Name | ethyl 4-(benzylideneamino)-5-sulfanylidene-1,2,4-triazole-1-carboxylate |
|---|---|
| PubChem CID | 3527365 |
| Molecular Formula | C12H12N4O2S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | ethyl 4-(benzylideneamino)-5-sulfanylidene-1,2,4-triazole-1-carboxylate |
| SMILES | CCOC(=O)n1ncn(N=Cc2ccccc2)c1=S |
| InChI | InChI=1S/C12H12N4O2S/c1-2-18-12(17)16-11(19)15(9-14-16)13-8-10-6-4-3-5-7-10/h3-9H,2H2,1H3 |
| InChIKey | CBEIJEKSONMVKW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 61.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|