C13H15N3O2 — CID 172994166
ethyl 3-benzyl-5-methyl-1,2,4-triazole-1-carboxylate (PubChem CID 172994166) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is ethyl 3-benzyl-5-methyl-1,2,4-triazole-1-carboxylate.
| Compound Name | ethyl 3-benzyl-5-methyl-1,2,4-triazole-1-carboxylate |
|---|---|
| PubChem CID | 172994166 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | ethyl 3-benzyl-5-methyl-1,2,4-triazole-1-carboxylate |
| SMILES | CCOC(=O)n1nc(Cc2ccccc2)nc1C |
| InChI | InChI=1S/C13H15N3O2/c1-3-18-13(17)16-10(2)14-12(15-16)9-11-7-5-4-6-8-11/h4-8H,3,9H2,1-2H3 |
| InChIKey | RINOEJUBOVZFEW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |