C16H18N4OS2 — CID 29429577
2-[[(3-methoxyphenyl)methyl-methylamino]methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione (PubChem CID 29429577) has the molecular formula C16H18N4OS2 and a molecular weight of 346.48 g/mol. Its IUPAC name is 2-[[(3-methoxyphenyl)methyl-methylamino]methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione.
| Compound Name | 2-[[(3-methoxyphenyl)methyl-methylamino]methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 29429577 |
| Molecular Formula | C16H18N4OS2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 2-[[(3-methoxyphenyl)methyl-methylamino]methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione |
| SMILES | COc1cccc(CN(C)Cn2[nH]c(-c3cccs3)nc2=S)c1 |
| InChI | InChI=1S/C16H18N4OS2/c1-19(10-12-5-3-6-13(9-12)21-2)11-20-16(22)17-15(18-20)14-7-4-8-23-14/h3-9H,10-11H2,1-2H3,(H,17,18,22) |
| InChIKey | CNFXCSBSVDCYQM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 46.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|