C16H17BrN4OS2 — CID 39742899
2-[[(5-bromothiophen-2-yl)methyl-methylamino]methyl]-5-(4-methoxyphenyl)-1H-1,2,4-triazole-3-thione (PubChem CID 39742899) has the molecular formula C16H17BrN4OS2 and a molecular weight of 425.38 g/mol. Its IUPAC name is 2-[[(5-bromothiophen-2-yl)methyl-methylamino]methyl]-5-(4-methoxyphenyl)-1H-1,2,4-triazole-3-thione.
| Compound Name | 2-[[(5-bromothiophen-2-yl)methyl-methylamino]methyl]-5-(4-methoxyphenyl)-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 39742899 |
| Molecular Formula | C16H17BrN4OS2 |
| Molecular Weight | 425.38 g/mol |
| Exact Mass | 424.00 |
| IUPAC Name | 2-[[(5-bromothiophen-2-yl)methyl-methylamino]methyl]-5-(4-methoxyphenyl)-1H-1,2,4-triazole-3-thione |
| SMILES | COc1ccc(-c2nc(=S)n(CN(C)Cc3ccc(Br)s3)[nH]2)cc1 |
| InChI | InChI=1S/C16H17BrN4OS2/c1-20(9-13-7-8-14(17)24-13)10-21-16(23)18-15(19-21)11-3-5-12(22-2)6-4-11/h3-8H,9-10H2,1-2H3,(H,18,19,23) |
| InChIKey | AFIWNDBXYUIBMR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 46.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|