C18H19BrN4OS — CID 31582659
2-[[(4-bromophenyl)methyl-methylamino]methyl]-5-(4-methoxyphenyl)-1H-1,2,4-triazole-3-thione (PubChem CID 31582659) has the molecular formula C18H19BrN4OS and a molecular weight of 419.35 g/mol. Its IUPAC name is 2-[[(4-bromophenyl)methyl-methylamino]methyl]-5-(4-methoxyphenyl)-1H-1,2,4-triazole-3-thione.
| Compound Name | 2-[[(4-bromophenyl)methyl-methylamino]methyl]-5-(4-methoxyphenyl)-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 31582659 |
| Molecular Formula | C18H19BrN4OS |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | 2-[[(4-bromophenyl)methyl-methylamino]methyl]-5-(4-methoxyphenyl)-1H-1,2,4-triazole-3-thione |
| SMILES | COc1ccc(-c2nc(=S)n(CN(C)Cc3ccc(Br)cc3)[nH]2)cc1 |
| InChI | InChI=1S/C18H19BrN4OS/c1-22(11-13-3-7-15(19)8-4-13)12-23-18(25)20-17(21-23)14-5-9-16(24-2)10-6-14/h3-10H,11-12H2,1-2H3,(H,20,21,25) |
| InChIKey | ZWYSAUJHFDJJTN-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 46.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|