C19H30N3O4+ — CID 8834075
N-(butylcarbamoyl)-2-[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]acetamide (PubChem CID 8834075) has the molecular formula C19H30N3O4+ and a molecular weight of 364.47 g/mol. Its IUPAC name is N-(butylcarbamoyl)-2-[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]acetamide.
| Compound Name | N-(butylcarbamoyl)-2-[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8834075 |
| Molecular Formula | C19H30N3O4+ |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | N-(butylcarbamoyl)-2-[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]acetamide |
| SMILES | CCCCNC(=O)NC(=O)C[NH+]1CCC[C@@H]1c1cc(OC)ccc1OC |
| InChI | InChI=1S/C19H29N3O4/c1-4-5-10-20-19(24)21-18(23)13-22-11-6-7-16(22)15-12-14(25-2)8-9-17(15)26-3/h8-9,12,16H,4-7,10-11,13H2,1-3H3,(H2,20,21,23,24)/p+1/t16-/m1/s1 |
| InChIKey | JFKIVWRLJCCWKM-MRXNPFEDSA-O |
| XLogP | 1.05 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|