C23H34N3O4+ — CID 8855987
N-[2-(cyclohexen-1-yl)ethylcarbamoyl]-2-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]acetamide (PubChem CID 8855987) has the molecular formula C23H34N3O4+ and a molecular weight of 416.54 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethylcarbamoyl]-2-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethylcarbamoyl]-2-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8855987 |
| Molecular Formula | C23H34N3O4+ |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethylcarbamoyl]-2-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]acetamide |
| SMILES | COc1ccc([C@H]2CCC[NH+]2CC(=O)NC(=O)NCCC2=CCCCC2)c(OC)c1 |
| InChI | InChI=1S/C23H33N3O4/c1-29-18-10-11-19(21(15-18)30-2)20-9-6-14-26(20)16-22(27)25-23(28)24-13-12-17-7-4-3-5-8-17/h7,10-11,15,20H,3-6,8-9,12-14,16H2,1-2H3,(H2,24,25,27,28)/p+1/t20-/m1/s1 |
| InChIKey | SRAXGDNRUUGYEF-HXUWFJFHSA-O |
| XLogP | 2.14 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|