C19H27N4O2S+ — CID 9285485
5-cyclopropyl-2-[[(2S)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-4-methyl-1,2,4-triazole-3-thione (PubChem CID 9285485) has the molecular formula C19H27N4O2S+ and a molecular weight of 375.52 g/mol. Its IUPAC name is 5-cyclopropyl-2-[[(2S)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-4-methyl-1,2,4-triazole-3-thione.
| Compound Name | 5-cyclopropyl-2-[[(2S)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-4-methyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 9285485 |
| Molecular Formula | C19H27N4O2S+ |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 5-cyclopropyl-2-[[(2S)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-4-methyl-1,2,4-triazole-3-thione |
| SMILES | COc1ccc([C@@H]2CCC[NH+]2Cn2nc(C3CC3)n(C)c2=S)c(OC)c1 |
| InChI | InChI=1S/C19H26N4O2S/c1-21-18(13-6-7-13)20-23(19(21)26)12-22-10-4-5-16(22)15-9-8-14(24-2)11-17(15)25-3/h8-9,11,13,16H,4-7,10,12H2,1-3H3/p+1/t16-/m0/s1 |
| InChIKey | HMYUXHNQFSRPAU-INIZCTEOSA-O |
| XLogP | 2.22 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|