C19H20N4O5 — CID 24981567
2-methyl-N'-[2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]furan-3-carbohydrazide (PubChem CID 24981567) has the molecular formula C19H20N4O5 and a molecular weight of 384.39 g/mol. Its IUPAC name is 2-methyl-N'-[2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]furan-3-carbohydrazide.
| Compound Name | 2-methyl-N'-[2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]furan-3-carbohydrazide |
|---|---|
| PubChem CID | 24981567 |
| Molecular Formula | C19H20N4O5 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 2-methyl-N'-[2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]furan-3-carbohydrazide |
| SMILES | Cc1ccc(C2(C)NC(=O)N(CC(=O)NNC(=O)c3ccoc3C)C2=O)cc1 |
| InChI | InChI=1S/C19H20N4O5/c1-11-4-6-13(7-5-11)19(3)17(26)23(18(27)20-19)10-15(24)21-22-16(25)14-8-9-28-12(14)2/h4-9H,10H2,1-3H3,(H,20,27)(H,21,24)(H,22,25) |
| InChIKey | TUYGXMKAQSHRBA-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|