C25H20ClFN4O4 — CID 55442567
N-(4-chlorophenyl)-2-[[2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide (PubChem CID 55442567) has the molecular formula C25H20ClFN4O4 and a molecular weight of 494.91 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[[2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide.
| Compound Name | N-(4-chlorophenyl)-2-[[2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 55442567 |
| Molecular Formula | C25H20ClFN4O4 |
| Molecular Weight | 494.91 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | N-(4-chlorophenyl)-2-[[2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide |
| SMILES | CC1(c2ccc(F)cc2)NC(=O)N(CC(=O)Nc2ccccc2C(=O)Nc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C25H20ClFN4O4/c1-25(15-6-10-17(27)11-7-15)23(34)31(24(35)30-25)14-21(32)29-20-5-3-2-4-19(20)22(33)28-18-12-8-16(26)9-13-18/h2-13H,14H2,1H3,(H,28,33)(H,29,32)(H,30,35) |
| InChIKey | DPILJEKKGJZTCS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.91 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|