C22H22ClFN4O4 — CID 55863349
N-(4-chlorophenyl)-4-[[2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]butanamide (PubChem CID 55863349) has the molecular formula C22H22ClFN4O4 and a molecular weight of 460.89 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[[2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]butanamide.
| Compound Name | N-(4-chlorophenyl)-4-[[2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]butanamide |
|---|---|
| PubChem CID | 55863349 |
| Molecular Formula | C22H22ClFN4O4 |
| Molecular Weight | 460.89 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | N-(4-chlorophenyl)-4-[[2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]butanamide |
| SMILES | CC1(c2ccc(F)cc2)NC(=O)N(CC(=O)NCCCC(=O)Nc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C22H22ClFN4O4/c1-22(14-4-8-16(24)9-5-14)20(31)28(21(32)27-22)13-19(30)25-12-2-3-18(29)26-17-10-6-15(23)7-11-17/h4-11H,2-3,12-13H2,1H3,(H,25,30)(H,26,29)(H,27,32) |
| InChIKey | DNCQCAPDKICEJF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.89 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|