C18H16IN3O3 — CID 2636303
N-(2-iodophenyl)-2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide (PubChem CID 2636303) has the molecular formula C18H16IN3O3 and a molecular weight of 449.25 g/mol. Its IUPAC name is N-(2-iodophenyl)-2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide.
| Compound Name | N-(2-iodophenyl)-2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 2636303 |
| Molecular Formula | C18H16IN3O3 |
| Molecular Weight | 449.25 g/mol |
| Exact Mass | 449.02 |
| IUPAC Name | N-(2-iodophenyl)-2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide |
| SMILES | C[C@]1(c2ccccc2)NC(=O)N(CC(=O)Nc2ccccc2I)C1=O |
| InChI | InChI=1S/C18H16IN3O3/c1-18(12-7-3-2-4-8-12)16(24)22(17(25)21-18)11-15(23)20-14-10-6-5-9-13(14)19/h2-10H,11H2,1H3,(H,20,23)(H,21,25)/t18-/m1/s1 |
| InChIKey | HHQCBPFGEGDBPL-GOSISDBHSA-N |
| XLogP | 2.70 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|