C22H23N3O3 — CID 51143066
2-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide (PubChem CID 51143066) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 2-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide.
| Compound Name | 2-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 51143066 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 2-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide |
| SMILES | CC1(c2ccccc2)NC(=O)N(CC(=O)Nc2cccc3c2CCCC3)C1=O |
| InChI | InChI=1S/C22H23N3O3/c1-22(16-10-3-2-4-11-16)20(27)25(21(28)24-22)14-19(26)23-18-13-7-9-15-8-5-6-12-17(15)18/h2-4,7,9-11,13H,5-6,8,12,14H2,1H3,(H,23,26)(H,24,28) |
| InChIKey | OUMLGDIMQZMNOF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|