C22H24N2O5 — CID 8894074
2-(4-methylphenoxy)ethyl 2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetate (PubChem CID 8894074) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is 2-(4-methylphenoxy)ethyl 2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetate.
| Compound Name | 2-(4-methylphenoxy)ethyl 2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 8894074 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 2-(4-methylphenoxy)ethyl 2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetate |
| SMILES | CC[C@]1(c2ccccc2)NC(=O)N(CC(=O)OCCOc2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C22H24N2O5/c1-3-22(17-7-5-4-6-8-17)20(26)24(21(27)23-22)15-19(25)29-14-13-28-18-11-9-16(2)10-12-18/h4-12H,3,13-15H2,1-2H3,(H,23,27)/t22-/m1/s1 |
| InChIKey | DLRYEHJQLOOUMY-JOCHJYFZSA-N |
| XLogP | 2.77 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|