C20H17N3O4 — CID 16548597
(4-cyanophenyl) 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetate (PubChem CID 16548597) has the molecular formula C20H17N3O4 and a molecular weight of 363.37 g/mol. Its IUPAC name is (4-cyanophenyl) 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetate.
| Compound Name | (4-cyanophenyl) 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 16548597 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | (4-cyanophenyl) 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetate |
| SMILES | CCC1(c2ccccc2)NC(=O)N(CC(=O)Oc2ccc(C#N)cc2)C1=O |
| InChI | InChI=1S/C20H17N3O4/c1-2-20(15-6-4-3-5-7-15)18(25)23(19(26)22-20)13-17(24)27-16-10-8-14(12-21)9-11-16/h3-11H,2,13H2,1H3,(H,22,26) |
| InChIKey | HLAREHPJMLSVHD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|