C22H23N3O3 — CID 55326801
4-[2-(4-butyl-2,5-dioxo-4-phenylimidazolidin-1-yl)ethoxy]benzonitrile (PubChem CID 55326801) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 4-[2-(4-butyl-2,5-dioxo-4-phenylimidazolidin-1-yl)ethoxy]benzonitrile.
| Compound Name | 4-[2-(4-butyl-2,5-dioxo-4-phenylimidazolidin-1-yl)ethoxy]benzonitrile |
|---|---|
| PubChem CID | 55326801 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 4-[2-(4-butyl-2,5-dioxo-4-phenylimidazolidin-1-yl)ethoxy]benzonitrile |
| SMILES | CCCCC1(c2ccccc2)NC(=O)N(CCOc2ccc(C#N)cc2)C1=O |
| InChI | InChI=1S/C22H23N3O3/c1-2-3-13-22(18-7-5-4-6-8-18)20(26)25(21(27)24-22)14-15-28-19-11-9-17(16-23)10-12-19/h4-12H,2-3,13-15H2,1H3,(H,24,27) |
| InChIKey | QUGSFUILUHZTHU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|