C20H17N3O3 — CID 51447055
4-[2-[(3S)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]ethoxy]benzonitrile (PubChem CID 51447055) has the molecular formula C20H17N3O3 and a molecular weight of 347.37 g/mol. Its IUPAC name is 4-[2-[(3S)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]ethoxy]benzonitrile.
| Compound Name | 4-[2-[(3S)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]ethoxy]benzonitrile |
|---|---|
| PubChem CID | 51447055 |
| Molecular Formula | C20H17N3O3 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 4-[2-[(3S)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]ethoxy]benzonitrile |
| SMILES | N#Cc1ccc(OCCN2C(=O)N[C@]3(CCc4ccccc43)C2=O)cc1 |
| InChI | InChI=1S/C20H17N3O3/c21-13-14-5-7-16(8-6-14)26-12-11-23-18(24)20(22-19(23)25)10-9-15-3-1-2-4-17(15)20/h1-8H,9-12H2,(H,22,25)/t20-/m0/s1 |
| InChIKey | SAZFWLUWRXTANA-FQEVSTJZSA-N |
| XLogP | 2.33 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|