C22H24N2O3 — CID 40819135
(5S)-3'-[2-(3-methylphenoxy)ethyl]spiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-imidazolidine]-2',4'-dione (PubChem CID 40819135) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is (5S)-3'-[2-(3-methylphenoxy)ethyl]spiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-imidazolidine]-2',4'-dione.
| Compound Name | (5S)-3'-[2-(3-methylphenoxy)ethyl]spiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 40819135 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (5S)-3'-[2-(3-methylphenoxy)ethyl]spiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-imidazolidine]-2',4'-dione |
| SMILES | Cc1cccc(OCCN2C(=O)N[C@]3(CCCCc4ccccc43)C2=O)c1 |
| InChI | InChI=1S/C22H24N2O3/c1-16-7-6-10-18(15-16)27-14-13-24-20(25)22(23-21(24)26)12-5-4-9-17-8-2-3-11-19(17)22/h2-3,6-8,10-11,15H,4-5,9,12-14H2,1H3,(H,23,26)/t22-/m0/s1 |
| InChIKey | DQSSVKMJLUDZQN-QFIPXVFZSA-N |
| XLogP | 3.55 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|