C23H21N3O4 — CID 42964488
3'-[2-(1,3-dioxoisoindol-2-yl)ethyl]spiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-imidazolidine]-2',4'-dione (PubChem CID 42964488) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is 3'-[2-(1,3-dioxoisoindol-2-yl)ethyl]spiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-imidazolidine]-2',4'-dione.
| Compound Name | 3'-[2-(1,3-dioxoisoindol-2-yl)ethyl]spiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 42964488 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 3'-[2-(1,3-dioxoisoindol-2-yl)ethyl]spiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1NC2(CCCCc3ccccc32)C(=O)N1CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H21N3O4/c27-19-16-9-2-3-10-17(16)20(28)25(19)13-14-26-21(29)23(24-22(26)30)12-6-5-8-15-7-1-4-11-18(15)23/h1-4,7,9-11H,5-6,8,12-14H2,(H,24,30) |
| InChIKey | FRURQJANTNZNCD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|