C22H30N2O5 — CID 7617394
[2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetate (PubChem CID 7617394) has the molecular formula C22H30N2O5 and a molecular weight of 402.49 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetate.
| Compound Name | [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 7617394 |
| Molecular Formula | C22H30N2O5 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetate |
| SMILES | CCCC1(CCC)NC(=O)N(CC(=O)OCC(=O)c2cc(C)c(C)cc2C)C1=O |
| InChI | InChI=1S/C22H30N2O5/c1-6-8-22(9-7-2)20(27)24(21(28)23-22)12-19(26)29-13-18(25)17-11-15(4)14(3)10-16(17)5/h10-11H,6-9,12-13H2,1-5H3,(H,23,28) |
| InChIKey | PIUOBANNMDLEEO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|