C20H29N3O5 — CID 7691332
[2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate (PubChem CID 7691332) has the molecular formula C20H29N3O5 and a molecular weight of 391.47 g/mol. Its IUPAC name is [2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate.
| Compound Name | [2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 7691332 |
| Molecular Formula | C20H29N3O5 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | [2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate |
| SMILES | CCCn1c(C)cc(C(=O)COC(=O)CN2C(=O)NC(CC)(CC)C2=O)c1C |
| InChI | InChI=1S/C20H29N3O5/c1-6-9-22-13(4)10-15(14(22)5)16(24)12-28-17(25)11-23-18(26)20(7-2,8-3)21-19(23)27/h10H,6-9,11-12H2,1-5H3,(H,21,27) |
| InChIKey | OCGMIAZRHRPSGX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|