C26H26N2O4 — CID 46567433
[2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate (PubChem CID 46567433) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is [2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate.
| Compound Name | [2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate |
|---|---|
| PubChem CID | 46567433 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | [2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate |
| SMILES | CCCn1c(C)cc(C(=O)COC(=O)Cn2c3ccccc3c(=O)c3ccccc32)c1C |
| InChI | InChI=1S/C26H26N2O4/c1-4-13-27-17(2)14-21(18(27)3)24(29)16-32-25(30)15-28-22-11-7-5-9-19(22)26(31)20-10-6-8-12-23(20)28/h5-12,14H,4,13,15-16H2,1-3H3 |
| InChIKey | DEVDCXWTAHENNV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|