C27H25NO4 — CID 16612511
[2-oxo-2-(2,3,4,5-tetramethylphenyl)ethyl] 2-(9-oxoacridin-10-yl)acetate (PubChem CID 16612511) has the molecular formula C27H25NO4 and a molecular weight of 427.50 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4,5-tetramethylphenyl)ethyl] 2-(9-oxoacridin-10-yl)acetate.
| Compound Name | [2-oxo-2-(2,3,4,5-tetramethylphenyl)ethyl] 2-(9-oxoacridin-10-yl)acetate |
|---|---|
| PubChem CID | 16612511 |
| Molecular Formula | C27H25NO4 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | [2-oxo-2-(2,3,4,5-tetramethylphenyl)ethyl] 2-(9-oxoacridin-10-yl)acetate |
| SMILES | Cc1cc(C(=O)COC(=O)Cn2c3ccccc3c(=O)c3ccccc32)c(C)c(C)c1C |
| InChI | InChI=1S/C27H25NO4/c1-16-13-22(19(4)18(3)17(16)2)25(29)15-32-26(30)14-28-23-11-7-5-9-20(23)27(31)21-10-6-8-12-24(21)28/h5-13H,14-15H2,1-4H3 |
| InChIKey | RMZHIOQTISKAFN-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|