C22H27NO5 — CID 92720078
[2-oxo-2-(2,3,4,5-tetramethylphenyl)ethyl] 2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate (PubChem CID 92720078) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4,5-tetramethylphenyl)ethyl] 2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate.
| Compound Name | [2-oxo-2-(2,3,4,5-tetramethylphenyl)ethyl] 2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate |
|---|---|
| PubChem CID | 92720078 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | [2-oxo-2-(2,3,4,5-tetramethylphenyl)ethyl] 2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate |
| SMILES | Cc1cc(C(=O)COC(=O)CN2C(=O)[C@H]3CCCC[C@@H]3C2=O)c(C)c(C)c1C |
| InChI | InChI=1S/C22H27NO5/c1-12-9-18(15(4)14(3)13(12)2)19(24)11-28-20(25)10-23-21(26)16-7-5-6-8-17(16)22(23)27/h9,16-17H,5-8,10-11H2,1-4H3/t16-,17-/m0/s1 |
| InChIKey | DQKAGSJVHMJXRV-IRXDYDNUSA-N |
| XLogP | 2.82 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|