C24H20N2O5S — CID 30911191
[2-[5-(acetamidomethyl)thiophen-2-yl]-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate (PubChem CID 30911191) has the molecular formula C24H20N2O5S and a molecular weight of 448.50 g/mol. Its IUPAC name is [2-[5-(acetamidomethyl)thiophen-2-yl]-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate.
| Compound Name | [2-[5-(acetamidomethyl)thiophen-2-yl]-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate |
|---|---|
| PubChem CID | 30911191 |
| Molecular Formula | C24H20N2O5S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | [2-[5-(acetamidomethyl)thiophen-2-yl]-2-oxoethyl] 2-(9-oxoacridin-10-yl)acetate |
| SMILES | CC(=O)NCc1ccc(C(=O)COC(=O)Cn2c3ccccc3c(=O)c3ccccc32)s1 |
| InChI | InChI=1S/C24H20N2O5S/c1-15(27)25-12-16-10-11-22(32-16)21(28)14-31-23(29)13-26-19-8-4-2-6-17(19)24(30)18-7-3-5-9-20(18)26/h2-11H,12-14H2,1H3,(H,25,27) |
| InChIKey | YIACLDOWNSBMRB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|