C17H16FNO5S — CID 8521287
[2-[5-(acetamidomethyl)thiophen-2-yl]-2-oxoethyl] 2-(2-fluorophenoxy)acetate (PubChem CID 8521287) has the molecular formula C17H16FNO5S and a molecular weight of 365.38 g/mol. Its IUPAC name is [2-[5-(acetamidomethyl)thiophen-2-yl]-2-oxoethyl] 2-(2-fluorophenoxy)acetate.
| Compound Name | [2-[5-(acetamidomethyl)thiophen-2-yl]-2-oxoethyl] 2-(2-fluorophenoxy)acetate |
|---|---|
| PubChem CID | 8521287 |
| Molecular Formula | C17H16FNO5S |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | [2-[5-(acetamidomethyl)thiophen-2-yl]-2-oxoethyl] 2-(2-fluorophenoxy)acetate |
| SMILES | CC(=O)NCc1ccc(C(=O)COC(=O)COc2ccccc2F)s1 |
| InChI | InChI=1S/C17H16FNO5S/c1-11(20)19-8-12-6-7-16(25-12)14(21)9-24-17(22)10-23-15-5-3-2-4-13(15)18/h2-7H,8-10H2,1H3,(H,19,20) |
| InChIKey | KJSRYPYFHQAWCH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |