C17H17NO6S2 — CID 8569042
[2-[5-(acetamidomethyl)thiophen-2-yl]-2-oxoethyl] 4-methylsulfonylbenzoate (PubChem CID 8569042) has the molecular formula C17H17NO6S2 and a molecular weight of 395.46 g/mol. Its IUPAC name is [2-[5-(acetamidomethyl)thiophen-2-yl]-2-oxoethyl] 4-methylsulfonylbenzoate.
| Compound Name | [2-[5-(acetamidomethyl)thiophen-2-yl]-2-oxoethyl] 4-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 8569042 |
| Molecular Formula | C17H17NO6S2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | [2-[5-(acetamidomethyl)thiophen-2-yl]-2-oxoethyl] 4-methylsulfonylbenzoate |
| SMILES | CC(=O)NCc1ccc(C(=O)COC(=O)c2ccc(S(C)(=O)=O)cc2)s1 |
| InChI | InChI=1S/C17H17NO6S2/c1-11(19)18-9-13-5-8-16(25-13)15(20)10-24-17(21)12-3-6-14(7-4-12)26(2,22)23/h3-8H,9-10H2,1-2H3,(H,18,19) |
| InChIKey | CRULMLXFGAHKAW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |