C16H13ClN2O6S — CID 31982134
[2-[5-(acetamidomethyl)thiophen-2-yl]-2-oxoethyl] 4-chloro-2-nitrobenzoate (PubChem CID 31982134) has the molecular formula C16H13ClN2O6S and a molecular weight of 396.81 g/mol. Its IUPAC name is [2-[5-(acetamidomethyl)thiophen-2-yl]-2-oxoethyl] 4-chloro-2-nitrobenzoate.
| Compound Name | [2-[5-(acetamidomethyl)thiophen-2-yl]-2-oxoethyl] 4-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 31982134 |
| Molecular Formula | C16H13ClN2O6S |
| Molecular Weight | 396.81 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | [2-[5-(acetamidomethyl)thiophen-2-yl]-2-oxoethyl] 4-chloro-2-nitrobenzoate |
| SMILES | CC(=O)NCc1ccc(C(=O)COC(=O)c2ccc(Cl)cc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C16H13ClN2O6S/c1-9(20)18-7-11-3-5-15(26-11)14(21)8-25-16(22)12-4-2-10(17)6-13(12)19(23)24/h2-6H,7-8H2,1H3,(H,18,20) |
| InChIKey | XZMHFKXZPAETPU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.81 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|