C20H20N2O8S — CID 30990190
[2-[5-[(2,2-dimethylpropanoylamino)methyl]thiophen-2-yl]-2-oxoethyl] 6-nitro-1,3-benzodioxole-5-carboxylate (PubChem CID 30990190) has the molecular formula C20H20N2O8S and a molecular weight of 448.45 g/mol. Its IUPAC name is [2-[5-[(2,2-dimethylpropanoylamino)methyl]thiophen-2-yl]-2-oxoethyl] 6-nitro-1,3-benzodioxole-5-carboxylate.
| Compound Name | [2-[5-[(2,2-dimethylpropanoylamino)methyl]thiophen-2-yl]-2-oxoethyl] 6-nitro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 30990190 |
| Molecular Formula | C20H20N2O8S |
| Molecular Weight | 448.45 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | [2-[5-[(2,2-dimethylpropanoylamino)methyl]thiophen-2-yl]-2-oxoethyl] 6-nitro-1,3-benzodioxole-5-carboxylate |
| SMILES | CC(C)(C)C(=O)NCc1ccc(C(=O)COC(=O)c2cc3c(cc2[N+](=O)[O-])OCO3)s1 |
| InChI | InChI=1S/C20H20N2O8S/c1-20(2,3)19(25)21-8-11-4-5-17(31-11)14(23)9-28-18(24)12-6-15-16(30-10-29-15)7-13(12)22(26)27/h4-7H,8-10H2,1-3H3,(H,21,25) |
| InChIKey | WZMJPGIXMUWJEC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|