C23H24N2O6S — CID 43028543
[2-[5-[(2,2-dimethylpropanoylamino)methyl]thiophen-2-yl]-2-oxoethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 43028543) has the molecular formula C23H24N2O6S and a molecular weight of 456.52 g/mol. Its IUPAC name is [2-[5-[(2,2-dimethylpropanoylamino)methyl]thiophen-2-yl]-2-oxoethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate.
| Compound Name | [2-[5-[(2,2-dimethylpropanoylamino)methyl]thiophen-2-yl]-2-oxoethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 43028543 |
| Molecular Formula | C23H24N2O6S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | [2-[5-[(2,2-dimethylpropanoylamino)methyl]thiophen-2-yl]-2-oxoethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | CC(C)(C)C(=O)NCc1ccc(C(=O)COC(=O)c2cccc(N3C(=O)CCC3=O)c2)s1 |
| InChI | InChI=1S/C23H24N2O6S/c1-23(2,3)22(30)24-12-16-7-8-18(32-16)17(26)13-31-21(29)14-5-4-6-15(11-14)25-19(27)9-10-20(25)28/h4-8,11H,9-10,12-13H2,1-3H3,(H,24,30) |
| InChIKey | INBJGLFFXNLATC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|