C20H17N3O6S3 — CID 30974098
[2-[5-(acetamidomethyl)thiophen-2-yl]-2-oxoethyl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate (PubChem CID 30974098) has the molecular formula C20H17N3O6S3 and a molecular weight of 491.57 g/mol. Its IUPAC name is [2-[5-(acetamidomethyl)thiophen-2-yl]-2-oxoethyl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate.
| Compound Name | [2-[5-(acetamidomethyl)thiophen-2-yl]-2-oxoethyl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 30974098 |
| Molecular Formula | C20H17N3O6S3 |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.03 |
| IUPAC Name | [2-[5-(acetamidomethyl)thiophen-2-yl]-2-oxoethyl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate |
| SMILES | CC(=O)NCc1ccc(C(=O)COC(=O)c2ccc(Sc3nc(C)cs3)c([N+](=O)[O-])c2)s1 |
| InChI | InChI=1S/C20H17N3O6S3/c1-11-10-30-20(22-11)32-17-5-3-13(7-15(17)23(27)28)19(26)29-9-16(25)18-6-4-14(31-18)8-21-12(2)24/h3-7,10H,8-9H2,1-2H3,(H,21,24) |
| InChIKey | NQRHXJWKATWUKH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 128.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|