About [2-(5-ethylthiophen-2-yl)-2-oxoethyl] 2-nitrobenzoate
[2-(5-ethylthiophen-2-yl)-2-oxoethyl] 2-nitrobenzoate (PubChem CID 18194948) has the molecular formula C15H13NO5S
and a molecular weight of 319.34 g/mol. Its IUPAC name is [2-(5-ethylthiophen-2-yl)-2-oxoethyl] 2-nitrobenzoate.
Molecular Properties
| Compound Name | [2-(5-ethylthiophen-2-yl)-2-oxoethyl] 2-nitrobenzoate |
| PubChem CID | 18194948 |
| Molecular Formula | C15H13NO5S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | [2-(5-ethylthiophen-2-yl)-2-oxoethyl] 2-nitrobenzoate |
| SMILES | CCc1ccc(C(=O)COC(=O)c2ccccc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C15H13NO5S/c1-2-10-7-8-14(22-10)13(17)9-21-15(18)11-5-3-4-6-12(11)16(19)20/h3-8H,2,9H2,1H3 |
| InChIKey | CSKJUOYAZGYABW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(5-ethylthiophen-2-yl)-2-oxoethyl] 2-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(5-ethylthiophen-2-yl)-2-oxoethyl] 2-nitrobenzoate?
The IUPAC name of [2-(5-ethylthiophen-2-yl)-2-oxoethyl] 2-nitrobenzoate (CID 18194948) is [2-(5-ethylthiophen-2-yl)-2-oxoethyl] 2-nitrobenzoate.
What is the SMILES notation for [2-(5-ethylthiophen-2-yl)-2-oxoethyl] 2-nitrobenzoate?
The canonical SMILES for [2-(5-ethylthiophen-2-yl)-2-oxoethyl] 2-nitrobenzoate is CCc1ccc(C(=O)COC(=O)c2ccccc2[N+](=O)[O-])s1.
What is the InChIKey of [2-(5-ethylthiophen-2-yl)-2-oxoethyl] 2-nitrobenzoate?
The InChIKey is CSKJUOYAZGYABW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO5S/c1-2-10-7-8-14(22-10)13(17)9-21-15(18)11-5-3-4-6-12(11)16(19)20/h3-8H,2,9H2,1H3.
What are the key properties of [2-(5-ethylthiophen-2-yl)-2-oxoethyl] 2-nitrobenzoate?
[2-(5-ethylthiophen-2-yl)-2-oxoethyl] 2-nitrobenzoate has a molecular weight of 319.34 g/mol, XLogP of 3.26, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(5-ethylthiophen-2-yl)-2-oxoethyl] 2-nitrobenzoate is sourced from PubChem (CID 18194948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).