C20H21NO6S — CID 9457981
[2-[4-(2-acetamidoethyl)phenyl]-2-oxoethyl] 4-methylsulfonylbenzoate (PubChem CID 9457981) has the molecular formula C20H21NO6S and a molecular weight of 403.46 g/mol. Its IUPAC name is [2-[4-(2-acetamidoethyl)phenyl]-2-oxoethyl] 4-methylsulfonylbenzoate.
| Compound Name | [2-[4-(2-acetamidoethyl)phenyl]-2-oxoethyl] 4-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 9457981 |
| Molecular Formula | C20H21NO6S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | [2-[4-(2-acetamidoethyl)phenyl]-2-oxoethyl] 4-methylsulfonylbenzoate |
| SMILES | CC(=O)NCCc1ccc(C(=O)COC(=O)c2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C20H21NO6S/c1-14(22)21-12-11-15-3-5-16(6-4-15)19(23)13-27-20(24)17-7-9-18(10-8-17)28(2,25)26/h3-10H,11-13H2,1-2H3,(H,21,22) |
| InChIKey | COODDDWJLPKDJC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |