C21H19NO5S2 — CID 55764758
N-[[5-[2-[4-(benzenesulfonyl)phenoxy]acetyl]thiophen-2-yl]methyl]acetamide (PubChem CID 55764758) has the molecular formula C21H19NO5S2 and a molecular weight of 429.52 g/mol. Its IUPAC name is N-[[5-[2-[4-(benzenesulfonyl)phenoxy]acetyl]thiophen-2-yl]methyl]acetamide.
| Compound Name | N-[[5-[2-[4-(benzenesulfonyl)phenoxy]acetyl]thiophen-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 55764758 |
| Molecular Formula | C21H19NO5S2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | N-[[5-[2-[4-(benzenesulfonyl)phenoxy]acetyl]thiophen-2-yl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc(C(=O)COc2ccc(S(=O)(=O)c3ccccc3)cc2)s1 |
| InChI | InChI=1S/C21H19NO5S2/c1-15(23)22-13-17-9-12-21(28-17)20(24)14-27-16-7-10-19(11-8-16)29(25,26)18-5-3-2-4-6-18/h2-12H,13-14H2,1H3,(H,22,23) |
| InChIKey | ZTFRUYBJSKJSSN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |